| MolName | (Z)-1-thiophen-3-yl-N-[(Z)-thiophen-3-ylmethylideneamino]methanimine |
| MolecularFormula | C10H8N2S2 |
| Smiles | C(c1cscc1)=N\N=C/c1cscc1 |
| InChI | InChI=1S/C10H8N2S2/c1-3-13-7-9(1)5-11-12-6-10-2-4-14-8-10/h1-8H |
| InChIK | GOWRAELJMIBCNE-UHFFFAOYSA-N |
| TotalMolweight | 220.32 |
| Molweight | 220.32 |
| MonoisotopicMass | 220.012888 |
| CLogP | 4.3544 |
| CLogS | -3.932 |
| H Acceptors | 2 |
| TotalSurfaceArea | 174.42 |
| Relative PSA | 0.36544 |
| PolarSurfaceArea | 81.2 |
| Druglikeness | 2.2614 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Symmetricatoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-thiophen-3-yl-N-[(Z)-thiophen-3-ylmethylideneamino]methanimine | 2 - (Z)-1-thiophen-3-yl-N-[(Z)-thiophen-3-ylmethylideneamino]methanimine