| MolName | N-[(Z)-(2-fluorophenyl)methylideneamino]-2-morpholin-4-ylsulfonyl-4-nitroaniline |
| MolecularFormula | C17H17N4O5FS |
| Smiles | [O-][N+](c(cc1)cc(S(N2CCOCC2)(=O)=O)c1N/N=C\c(cccc1)c1F)=O |
| InChI | InChI=1S/C17H17FN4O5S/c18-15-4-2-1-3-13(15)12-19-20-16-6-5-14(22(23)24)11-17(16)28(25,26)21-7-9-27-10-8-21/h1-6,11-12,20H,7-10H2 |
| InChIK | GPDVAZJLOPWYPW-UHFFFAOYSA-N |
| TotalMolweight | 408.409 |
| Molweight | 408.409 |
| MonoisotopicMass | 408.090369 |
| CLogP | 3.0629 |
| CLogS | -3.129 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 289.68 |
| Relative PSA | 0.32974 |
| PolarSurfaceArea | 125.2 |
| Druglikeness | -4.671 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-fluorophenyl)methylideneamino]-2-morpholin-4-ylsulfonyl-4-nitroaniline | 2 - N-[(Z)-(2-fluorophenyl)methylideneamino]-2-morpholin-4-ylsulfonyl-4-nitroaniline