| MolName | 4-(4-benzylpiperazin-1-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-6-(3,3,3-trifluoropropoxy)-1,3,5-triazin-2-amine |
| MolecularFormula | C24H25N8O3F3 |
| Smiles | [O-][N+](c1ccc(/C=N\Nc2nc(OCCC(F)(F)F)nc(N3CCN(Cc4ccccc4)CC3)n2)cc1)=O |
| InChI | InChI=1S/C24H25F3N8O3/c25-24(26,27)10-15-38-23-30-21(32-28-16-18-6-8-20(9-7-18)35(36)37)29-22(31-23)34-13-11-33(12-14-34)17-19-4-2-1-3-5-19/h1-9,16H,10-15,17H2,(H,29,30,31,32) |
| InChIK | GPHDIIUBYXADKS-UHFFFAOYSA-N |
| TotalMolweight | 530.51 |
| Molweight | 530.51 |
| MonoisotopicMass | 530.200171 |
| CLogP | 4.8859 |
| CLogS | -6.051 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 391.83 |
| Relative PSA | 0.26389 |
| PolarSurfaceArea | 124.59 |
| Druglikeness | -10.713 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 11 |
| Symmetricatoms | 8 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(4-benzylpiperazin-1-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-6-(3,3,3-trifluoropropoxy)-1,3,5-triazin-2-amine | 2 - 4-(4-benzylpiperazin-1-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-6-(3,3,3-trifluoropropoxy)-1,3,5-triazin-2-amine