| MolName | (5E)-3-[(Z)-benzylideneamino]-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C21H12N2O2Cl2S2 |
| Smiles | O=C(/C(/SC1=S)=C\c2ccc(-c(ccc(Cl)c3)c3Cl)o2)N1/N=C\c1ccccc1 |
| InChI | InChI=1S/C21H12Cl2N2O2S2/c22-14-6-8-16(17(23)10-14)18-9-7-15(27-18)11-19-20(26)25(21(28)29-19)24-12-13-4-2-1-3-5-13/h1-12H |
| InChIK | GPOJLKLYLDLMMJ-UHFFFAOYSA-N |
| TotalMolweight | 459.376 |
| Molweight | 459.376 |
| MonoisotopicMass | 457.971722 |
| CLogP | 5.2061 |
| CLogS | -8.027 |
| H Acceptors | 4 |
| TotalSurfaceArea | 327.53 |
| Relative PSA | 0.26776 |
| PolarSurfaceArea | 103.2 |
| Druglikeness | 5.6769 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (5E)-3-[(Z)-benzylideneamino]-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - (5E)-3-[(Z)-benzylideneamino]-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one