| MolName | N,N'-bis[(Z)-[2-(cyanomethoxy)phenyl]methylideneamino]oxamide |
| MolecularFormula | C20H16N6O4 |
| Smiles | N#CCOc1c(/C=N\NC(C(N/N=C\c(cccc2)c2OCC#N)=O)=O)cccc1 |
| InChI | InChI=1S/C20H16N6O4/c21-9-11-29-17-7-3-1-5-15(17)13-23-25-19(27)20(28)26-24-14-16-6-2-4-8-18(16)30-12-10-22/h1-8,13-14H,11-12H2,(H,25,27)(H,26,28) |
| InChIK | GPROCARKECTGLX-UHFFFAOYSA-N |
| TotalMolweight | 404.385 |
| Molweight | 404.385 |
| MonoisotopicMass | 404.123304 |
| CLogP | 1.7022 |
| CLogS | -5.05 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 331.9 |
| Relative PSA | 0.35896 |
| PolarSurfaceArea | 148.96 |
| Druglikeness | -1.3445 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 15 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-[2-(cyanomethoxy)phenyl]methylideneamino]oxamide | 2 - N,N'-bis[(Z)-[2-(cyanomethoxy)phenyl]methylideneamino]oxamide