| MolName | (Z)-1-phenyl-N-(5-phenyltetrazol-2-yl)methanimine |
| MolecularFormula | C14H11N5 |
| Smiles | C(c1ccccc1)=N\n1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H11N5/c1-3-7-12(8-4-1)11-15-19-17-14(16-18-19)13-9-5-2-6-10-13/h1-11H |
| InChIK | GPYIRVHJVCDUQC-UHFFFAOYSA-N |
| TotalMolweight | 249.276 |
| Molweight | 249.276 |
| MonoisotopicMass | 249.101445 |
| CLogP | 2.7801 |
| CLogS | -4.088 |
| H Acceptors | 5 |
| TotalSurfaceArea | 203.02 |
| Relative PSA | 0.25264 |
| PolarSurfaceArea | 55.96 |
| Druglikeness | -2.2903 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-phenyl-N-(5-phenyltetrazol-2-yl)methanimine | 2 - (Z)-1-phenyl-N-(5-phenyltetrazol-2-yl)methanimine