| MolName | (Z)-3-[(Z)-(2-chlorophenyl)methylideneamino]-N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-imine |
| MolecularFormula | C22H23N4OClS |
| Smiles | Clc1c(/C=N\N(C(c2ccccc2)=CS2)/C2=N/CCN2CCOCC2)cccc1 |
| InChI | InChI=1S/C22H23ClN4OS/c23-20-9-5-4-8-19(20)16-25-27-21(18-6-2-1-3-7-18)17-29-22(27)24-10-11-26-12-14-28-15-13-26/h1-9,16-17H,10-15H2 |
| InChIK | GQAOMAIMUFOUJX-UHFFFAOYSA-N |
| TotalMolweight | 426.971 |
| Molweight | 426.971 |
| MonoisotopicMass | 426.128108 |
| CLogP | 4.3248 |
| CLogS | -4.698 |
| H Acceptors | 5 |
| TotalSurfaceArea | 324.53 |
| Relative PSA | 0.17752 |
| PolarSurfaceArea | 65.73 |
| Druglikeness | 5.8387 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-3-[(Z)-(2-chlorophenyl)methylideneamino]-N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-imine | 2 - (Z)-3-[(Z)-(2-chlorophenyl)methylideneamino]-N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-imine