| MolName | 3-[[(Z)-benzylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide |
| MolecularFormula | C23H26N4O3S |
| Smiles | O=C(CCN(C(c1c2cccc1)=NS2(=O)=O)/N=C\c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C23H26N4O3S/c28-22(25-19-11-5-2-6-12-19)15-16-27(24-17-18-9-3-1-4-10-18)23-20-13-7-8-14-21(20)31(29,30)26-23/h1,3-4,7-10,13-14,17,19H,2,5-6,11-12,15-16H2,(H,25,28) |
| InChIK | GQCRKYHAVVMOGF-UHFFFAOYSA-N |
| TotalMolweight | 438.55 |
| Molweight | 438.55 |
| MonoisotopicMass | 438.172561 |
| CLogP | 3.9703 |
| CLogS | -4.833 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 330.66 |
| Relative PSA | 0.24088 |
| PolarSurfaceArea | 99.58 |
| Druglikeness | 1.3944 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 5 |
| Amides | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[(Z)-benzylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide | 2 - 3-[[(Z)-benzylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide