| MolName | 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C17H15N3O2S2 |
| Smiles | C1COc(cc(cc2)-c3cnc(N/N=C\c4cccs4)s3)c2OC1 |
| InChI | InChI=1S/C17H15N3O2S2/c1-3-13(23-8-1)10-19-20-17-18-11-16(24-17)12-4-5-14-15(9-12)22-7-2-6-21-14/h1,3-5,8-11H,2,6-7H2,(H,18,20) |
| InChIK | GQFJBQIVMHABOG-UHFFFAOYSA-N |
| TotalMolweight | 357.457 |
| Molweight | 357.457 |
| MonoisotopicMass | 357.060567 |
| CLogP | 6.5519 |
| CLogS | -5.451 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 267.42 |
| Relative PSA | 0.35398 |
| PolarSurfaceArea | 112.22 |
| Druglikeness | 3.4247 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 5 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazol-2-amine | 2 - 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazol-2-amine