| MolName | 1-[(Z)-[(3E)-3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-naphthalen-1-ylthiourea |
| MolecularFormula | C28H26N4OCl2S |
| Smiles | S=C(Nc1cccc2ccccc12)N/N=C\C(CC/C1=C\c(ccc(Cl)c2)c2Cl)=C1N1CCOCC1 |
| InChI | InChI=1S/C28H26Cl2N4OS/c29-23-11-10-20(25(30)17-23)16-21-8-9-22(27(21)34-12-14-35-15-13-34)18-31-33-28(36)32-26-7-3-5-19-4-1-2-6-24(19)26/h1-7,10-11,16-18H,8-9,12-15H2,(H2,32,33,36) |
| InChIK | GQGCOHIKVDFNOX-UHFFFAOYSA-N |
| TotalMolweight | 537.513 |
| Molweight | 537.513 |
| MonoisotopicMass | 536.120435 |
| CLogP | 6.5781 |
| CLogS | -7.965 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 402.34 |
| Relative PSA | 0.18885 |
| PolarSurfaceArea | 80.98 |
| Druglikeness | 3.2247 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[(3E)-3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-naphthalen-1-ylthiourea | 2 - 1-[(Z)-[(3E)-3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-naphthalen-1-ylthiourea