| MolName | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[1-[(4-bromophenyl)methyl]-3-(4-chlorophenyl)pyrazol-4-yl]methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C28H27N11O2BrCl |
| Smiles | Nc1nonc1-n1nnc(CN2CCCCC2)c1C(N/N=C\c1cn(Cc(cc2)ccc2Br)nc1-c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C28H27BrClN11O2/c29-21-8-4-18(5-9-21)15-40-16-20(24(35-40)19-6-10-22(30)11-7-19)14-32-34-28(42)25-23(17-39-12-2-1-3-13-39)33-38-41(25)27-26(31)36-43-37-27/h4-11,14,16H,1-3,12-13,15,17H2,(H2,31,36)(H,34,42) |
| InChIK | GQLJUYVNDGJKOF-UHFFFAOYSA-N |
| TotalMolweight | 664.954 |
| Molweight | 664.954 |
| MonoisotopicMass | 663.122107 |
| CLogP | 5.0065 |
| CLogS | -4.827 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 463.85 |
| Relative PSA | 0.2965 |
| PolarSurfaceArea | 158.17 |
| Druglikeness | 0.57813 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46512 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 7 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[1-[(4-bromophenyl)methyl]-3-(4-chlorophenyl)pyrazol-4-yl]methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide | 2 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[1-[(4-bromophenyl)methyl]-3-(4-chlorophenyl)pyrazol-4-yl]methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide