| MolName | 3-benzylsulfanyl-5-[(2Z)-2-[(3-iodophenyl)methylidene]hydrazinyl]-1,2-thiazole-4-carbonitrile |
| MolecularFormula | C18H13N4IS2 |
| Smiles | N#Cc1c(N/N=C\c2cccc(I)c2)snc1SCc1ccccc1 |
| InChI | InChI=1S/C18H13IN4S2/c19-15-8-4-7-14(9-15)11-21-22-17-16(10-20)18(23-25-17)24-12-13-5-2-1-3-6-13/h1-9,11,22H,12H2 |
| InChIK | GQNPYRYUYGJXBH-UHFFFAOYSA-N |
| TotalMolweight | 476.361 |
| Molweight | 476.361 |
| MonoisotopicMass | 475.962634 |
| CLogP | 6.6377 |
| CLogS | -5.52 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 302.94 |
| Relative PSA | 0.28174 |
| PolarSurfaceArea | 114.61 |
| Druglikeness | 0.044039 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-benzylsulfanyl-5-[(2Z)-2-[(3-iodophenyl)methylidene]hydrazinyl]-1,2-thiazole-4-carbonitrile | 2 - 3-benzylsulfanyl-5-[(2Z)-2-[(3-iodophenyl)methylidene]hydrazinyl]-1,2-thiazole-4-carbonitrile