| MolName | N-[(Z)-[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| MolecularFormula | C20H22N3O3F |
| Smiles | O=C(CN1CCOCC1)N/N=C\c(cc1)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C20H22FN3O3/c21-18-3-1-2-17(12-18)15-27-19-6-4-16(5-7-19)13-22-23-20(25)14-24-8-10-26-11-9-24/h1-7,12-13H,8-11,14-15H2,(H,23,25) |
| InChIK | GQUYFCJSKFTBAK-UHFFFAOYSA-N |
| TotalMolweight | 371.411 |
| Molweight | 371.411 |
| MonoisotopicMass | 371.16452 |
| CLogP | 2.4692 |
| CLogS | -3.396 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 292.7 |
| Relative PSA | 0.20348 |
| PolarSurfaceArea | 63.16 |
| Druglikeness | 4.0936 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide | 2 - N-[(Z)-[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide