| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| MolecularFormula | C23H16N4OS |
| Smiles | O=C(c1n[nH]c(-c2cccs2)c1)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C23H16N4OS/c28-23(21-13-20(25-26-21)22-10-5-11-29-22)27-24-14-19-17-8-3-1-6-15(17)12-16-7-2-4-9-18(16)19/h1-14H,(H,25,26)(H,27,28) |
| InChIK | GRDIOGDKROIAPQ-UHFFFAOYSA-N |
| TotalMolweight | 396.473 |
| Molweight | 396.473 |
| MonoisotopicMass | 396.104481 |
| CLogP | 5.3117 |
| CLogS | -7.229 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 300.22 |
| Relative PSA | 0.2709 |
| PolarSurfaceArea | 98.38 |
| Druglikeness | 7.526 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide