| MolName | N-[(Z)-(3-phenoxyphenyl)methylideneamino]adamantane-1-carboxamide |
| MolecularFormula | C24H26N2O2 |
| Smiles | O=C(C1(CC(C2)C3)CC3CC2C1)N/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C24H26N2O2/c27-23(24-13-18-9-19(14-24)11-20(10-18)15-24)26-25-16-17-5-4-8-22(12-17)28-21-6-2-1-3-7-21/h1-8,12,16,18-20H,9-11,13-15H2,(H,26,27) |
| InChIK | GRGMNOOVHXLEGA-UHFFFAOYSA-N |
| TotalMolweight | 374.482 |
| Molweight | 374.482 |
| MonoisotopicMass | 374.199428 |
| CLogP | 5.0505 |
| CLogS | -7.003 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 286.96 |
| Relative PSA | 0.16034 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 5.148 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-phenoxyphenyl)methylideneamino]adamantane-1-carboxamide | 2 - N-[(Z)-(3-phenoxyphenyl)methylideneamino]adamantane-1-carboxamide