| MolName | 4-bromo-5-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzene-1,3-diol |
| MolecularFormula | C18H22N7O4Br |
| Smiles | Oc(cc1/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc(O)c1Br |
| InChI | InChI=1S/C18H22BrN7O4/c19-15-12(9-13(27)10-14(15)28)11-20-24-16-21-17(25-1-5-29-6-2-25)23-18(22-16)26-3-7-30-8-4-26/h9-11,27-28H,1-8H2,(H,21,22,23,24) |
| InChIK | GRIGZOFURNAVSC-UHFFFAOYSA-N |
| TotalMolweight | 480.322 |
| Molweight | 480.322 |
| MonoisotopicMass | 479.091664 |
| CLogP | 3.6343 |
| CLogS | -3.783 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 320.53 |
| Relative PSA | 0.34062 |
| PolarSurfaceArea | 128.46 |
| Druglikeness | 1.4751 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 12 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-bromo-5-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzene-1,3-diol | 2 - 4-bromo-5-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzene-1,3-diol