| MolName | 3-(1,3-benzodioxol-5-yl)-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C18H14N4O4 |
| Smiles | Oc1cccc(/C=N\NC(c2cc(-c(cc3)cc4c3OCO4)n[nH]2)=O)c1 |
| InChI | InChI=1S/C18H14N4O4/c23-13-3-1-2-11(6-13)9-19-22-18(24)15-8-14(20-21-15)12-4-5-16-17(7-12)26-10-25-16/h1-9,23H,10H2,(H,20,21)(H,22,24) |
| InChIK | GSMLKIZHAYRAHI-UHFFFAOYSA-N |
| TotalMolweight | 350.333 |
| Molweight | 350.333 |
| MonoisotopicMass | 350.101506 |
| CLogP | 2.6651 |
| CLogS | -4.511 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 261.69 |
| Relative PSA | 0.35947 |
| PolarSurfaceArea | 108.83 |
| Druglikeness | 5.4886 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(1,3-benzodioxol-5-yl)-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide | 2 - 3-(1,3-benzodioxol-5-yl)-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide