| MolName | N'-[(Z)-(2-chlorophenyl)methylideneamino]-N-phenyloxamide |
| MolecularFormula | C15H12N3O2Cl |
| Smiles | O=C(C(N/N=C\c(cccc1)c1Cl)=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H12ClN3O2/c16-13-9-5-4-6-11(13)10-17-19-15(21)14(20)18-12-7-2-1-3-8-12/h1-10H,(H,18,20)(H,19,21) |
| InChIK | GSVUMTXPAHZYEO-UHFFFAOYSA-N |
| TotalMolweight | 301.732 |
| Molweight | 301.732 |
| MonoisotopicMass | 301.061804 |
| CLogP | 2.7499 |
| CLogS | -4.261 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 231.62 |
| Relative PSA | 0.26125 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 3.76 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(2-chlorophenyl)methylideneamino]-N-phenyloxamide | 2 - N'-[(Z)-(2-chlorophenyl)methylideneamino]-N-phenyloxamide