| MolName | N-[(2S)-1-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)hydrazinyl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]thiophene-2-carboxamide |
| MolecularFormula | C25H22N4O4S |
| Smiles | O=C([C@H](Cc1c[nH]c2c1cccc2)NC(c1cccs1)=O)N/N=C\c(cc1)cc2c1OCCO2 |
| InChI | InChI=1S/C25H22N4O4S/c30-24(29-27-14-16-7-8-21-22(12-16)33-10-9-32-21)20(28-25(31)23-6-3-11-34-23)13-17-15-26-19-5-2-1-4-18(17)19/h1-8,11-12,14-15,20,26H,9-10,13H2,(H,28,31)(H,29,30)/t20-/m0/s1 |
| InChIK | GTGMHYPNLHRHOH-FQEVSTJZSA-N |
| TotalMolweight | 474.54 |
| Molweight | 474.54 |
| MonoisotopicMass | 474.136176 |
| CLogP | 3.9713 |
| CLogS | -5.718 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 356.35 |
| Relative PSA | 0.32232 |
| PolarSurfaceArea | 133.05 |
| Druglikeness | 1.6234 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 6 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - N-[(2S)-1-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)hydrazinyl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]thiophene-2-carboxamide | 2 - N-[(2S)-1-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)hydrazinyl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]thiophene-2-carboxamide