| MolName | 4-[(2Z)-2-[[4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]benzoic acid |
| MolecularFormula | C15H11N2O3F3 |
| Smiles | OC(c(cc1)ccc1N/N=C\c(cc1)ccc1OC(F)(F)F)=O |
| InChI | InChI=1S/C15H11F3N2O3/c16-15(17,18)23-13-7-1-10(2-8-13)9-19-20-12-5-3-11(4-6-12)14(21)22/h1-9,20H,(H,21,22) |
| InChIK | GTOUTESKGQDMMZ-UHFFFAOYSA-N |
| TotalMolweight | 324.257 |
| Molweight | 324.257 |
| MonoisotopicMass | 324.072177 |
| CLogP | 5.425 |
| CLogS | -4.185 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 232.8 |
| Relative PSA | 0.25391 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | -6.2177 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[[4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]benzoic acid | 2 - 4-[(2Z)-2-[[4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]benzoic acid