| MolName | 3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C13H14N4O5 |
| Smiles | [O-][N+](c1ccc(/C=N\N(C(C2(CCCCC2)N2)=O)C2=O)o1)=O |
| InChI | InChI=1S/C13H14N4O5/c18-11-13(6-2-1-3-7-13)15-12(19)16(11)14-8-9-4-5-10(22-9)17(20)21/h4-5,8H,1-3,6-7H2,(H,15,19) |
| InChIK | GTQBCDXGOHIBJC-UHFFFAOYSA-N |
| TotalMolweight | 306.277 |
| Molweight | 306.277 |
| MonoisotopicMass | 306.096421 |
| CLogP | 0.7693 |
| CLogS | -4.403 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 220.85 |
| Relative PSA | 0.4398 |
| PolarSurfaceArea | 120.73 |
| Druglikeness | 0.37951 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione