| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C28H31N7 |
| Smiles | C(CC1)CCN1c1nc(N/N=C\c2c(cccc3)c3cc3ccccc23)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C28H31N7/c1-7-15-34(16-8-1)27-30-26(31-28(32-27)35-17-9-2-10-18-35)33-29-20-25-23-13-5-3-11-21(23)19-22-12-4-6-14-24(22)25/h3-6,11-14,19-20H,1-2,7-10,15-18H2,(H,30,31,32,33) |
| InChIK | GTZLOMCYZKNREF-UHFFFAOYSA-N |
| TotalMolweight | 465.603 |
| Molweight | 465.603 |
| MonoisotopicMass | 465.264093 |
| CLogP | 8.3173 |
| CLogS | -8.531 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 365.92 |
| Relative PSA | 0.17211 |
| PolarSurfaceArea | 69.54 |
| Druglikeness | 2.872 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.42857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 10 |
| Symmetricatoms | 16 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine