| MolName | 2-cyano-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
| MolecularFormula | C10H8N3OF |
| Smiles | N#CCC(N/N=C\c(cccc1)c1F)=O |
| InChI | InChI=1S/C10H8FN3O/c11-9-4-2-1-3-8(9)7-13-14-10(15)5-6-12/h1-4,7H,5H2,(H,14,15) |
| InChIK | GUAKCQJDAYPSJZ-UHFFFAOYSA-N |
| TotalMolweight | 205.192 |
| Molweight | 205.192 |
| MonoisotopicMass | 205.06514 |
| CLogP | 1.5586 |
| CLogS | -3.283 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 169.05 |
| Relative PSA | 0.29323 |
| PolarSurfaceArea | 65.25 |
| Druglikeness | -4.2095 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73333 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-cyano-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide | 2 - 2-cyano-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide