| MolName | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide |
| MolecularFormula | C24H18N4O3S2 |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(c2ccc(CSc3nc(cccc4)c4s3)cc2)=O)cccc1)=O |
| InChI | InChI=1S/C24H18N4O3S2/c29-23(27-25-15-5-7-18-6-1-3-9-21(18)28(30)31)19-13-11-17(12-14-19)16-32-24-26-20-8-2-4-10-22(20)33-24/h1-15H,16H2,(H,27,29) |
| InChIK | GUEBBIGVFRFMEE-UHFFFAOYSA-N |
| TotalMolweight | 474.564 |
| Molweight | 474.564 |
| MonoisotopicMass | 474.082031 |
| CLogP | 4.7616 |
| CLogS | -7.738 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 357.47 |
| Relative PSA | 0.3224 |
| PolarSurfaceArea | 153.71 |
| Druglikeness | -0.3877 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide | 2 - 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide