| MolName | 3-(2,4-dichlorophenyl)-4-[(Z)-naphthalen-1-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C19H12N4Cl2S |
| Smiles | S=C(NN=C1c(ccc(Cl)c2)c2Cl)N1/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C19H12Cl2N4S/c20-14-8-9-16(17(21)10-14)18-23-24-19(26)25(18)22-11-13-6-3-5-12-4-1-2-7-15(12)13/h1-11H,(H,24,26) |
| InChIK | GUGCGEYBYJXKLY-UHFFFAOYSA-N |
| TotalMolweight | 399.304 |
| Molweight | 399.304 |
| MonoisotopicMass | 398.01597 |
| CLogP | 5.7014 |
| CLogS | -7.529 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 287.16 |
| Relative PSA | 0.22994 |
| PolarSurfaceArea | 72.08 |
| Druglikeness | 3.6145 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2,4-dichlorophenyl)-4-[(Z)-naphthalen-1-ylmethylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2,4-dichlorophenyl)-4-[(Z)-naphthalen-1-ylmethylideneamino]-1H-1,2,4-triazole-5-thione