| MolName | 4-nitro-N-[5-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| MolecularFormula | C18H13N7O6S |
| Smiles | [O-][N+](c(cc1)ccc1C(Nc1nnc(CC(N/N=C\c2cc([N+]([O-])=O)ccc2)=O)s1)=O)=O |
| InChI | InChI=1S/C18H13N7O6S/c26-15(21-19-10-11-2-1-3-14(8-11)25(30)31)9-16-22-23-18(32-16)20-17(27)12-4-6-13(7-5-12)24(28)29/h1-8,10H,9H2,(H,21,26)(H,20,23,27) |
| InChIK | GUHAWHQFUYYEIK-UHFFFAOYSA-N |
| TotalMolweight | 455.41 |
| Molweight | 455.41 |
| MonoisotopicMass | 455.064803 |
| CLogP | 1.347 |
| CLogS | -5.325 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 330.52 |
| Relative PSA | 0.49513 |
| PolarSurfaceArea | 216.22 |
| Druglikeness | 1.4073 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-nitro-N-[5-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide | 2 - 4-nitro-N-[5-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide