| MolName | N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C17H19N3O3S |
| Smiles | O=S(c1ccccc1)(N/N=C\c(cc1)ccc1N1CCOCC1)=O |
| InChI | InChI=1S/C17H19N3O3S/c21-24(22,17-4-2-1-3-5-17)19-18-14-15-6-8-16(9-7-15)20-10-12-23-13-11-20/h1-9,14,19H,10-13H2 |
| InChIK | GURFEJXMHQFUDX-UHFFFAOYSA-N |
| TotalMolweight | 345.422 |
| Molweight | 345.422 |
| MonoisotopicMass | 345.114712 |
| CLogP | 1.9461 |
| CLogS | -2.019 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 259.66 |
| Relative PSA | 0.25071 |
| PolarSurfaceArea | 79.38 |
| Druglikeness | -3.77 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 7 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzenesulfonamide