| MolName | 2-[(Z)-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C26H21N4O4S2 |
| Smiles | [O-]C(c1c(/C=N\NC(CSC(N2c3ccccc3)=Nc(sc3c4CCCC3)c4C2=O)=O)cccc1)=O |
| InChI | InChI=1S/C26H22N4O4S2/c31-21(29-27-14-16-8-4-5-11-18(16)25(33)34)15-35-26-28-23-22(19-12-6-7-13-20(19)36-23)24(32)30(26)17-9-2-1-3-10-17/h1-5,8-11,14H,6-7,12-13,15H2,(H,29,31)(H,33,34)/p-1 |
| InChIK | GUSHLUFLRMSTLJ-UHFFFAOYSA-M |
| TotalMolweight | 517.609 |
| Molweight | 517.609 |
| MonoisotopicMass | 517.100421 |
| CLogP | 2.8326 |
| CLogS | -7.39 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 378.28 |
| Relative PSA | 0.34176 |
| PolarSurfaceArea | 167.8 |
| Druglikeness | 2.5116 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.47222 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]benzoate | 2 - 2-[(Z)-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]benzoate