| MolName | 2-[(Z)-[(2Z)-2-(diaminomethylidenehydrazinylidene)-1-phenylethylidene]amino]guanidine |
| MolecularFormula | C10H14N8 |
| Smiles | NC(N)=N/N=C\C(\c1ccccc1)=N/N=C(N)N |
| InChI | InChI=1S/C10H14N8/c11-9(12)17-15-6-8(16-18-10(13)14)7-4-2-1-3-5-7/h1-6H,(H4,11,12,17)(H4,13,14,18) |
| InChIK | GUWYZFXTOZCQRE-UHFFFAOYSA-N |
| TotalMolweight | 246.277 |
| Molweight | 246.277 |
| MonoisotopicMass | 246.134142 |
| CLogP | 0.9526 |
| CLogS | -4.108 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 201.01 |
| Relative PSA | 0.53291 |
| PolarSurfaceArea | 153.52 |
| Druglikeness | 1.7978 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Symmetricatoms | 4 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[(2Z)-2-(diaminomethylidenehydrazinylidene)-1-phenylethylidene]amino]guanidine | 2 - 2-[(Z)-[(2Z)-2-(diaminomethylidenehydrazinylidene)-1-phenylethylidene]amino]guanidine