| MolName | 2,4-difluoro-N-[(Z)-(4-phenylphenyl)methylideneamino]aniline |
| MolecularFormula | C19H14N2F2 |
| Smiles | Fc(cc1)cc(F)c1N/N=C\c(cc1)ccc1-c1ccccc1 |
| InChI | InChI=1S/C19H14F2N2/c20-17-10-11-19(18(21)12-17)23-22-13-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-13,23H |
| InChIK | GVAPYEFMSDWJGX-UHFFFAOYSA-N |
| TotalMolweight | 308.33 |
| Molweight | 308.33 |
| MonoisotopicMass | 308.112504 |
| CLogP | 6.7017 |
| CLogS | -5.863 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 241.7 |
| Relative PSA | 0.095035 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | 1.0825 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-difluoro-N-[(Z)-(4-phenylphenyl)methylideneamino]aniline | 2 - 2,4-difluoro-N-[(Z)-(4-phenylphenyl)methylideneamino]aniline