| MolName | N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
| MolecularFormula | C21H15N4O2BrS2 |
| Smiles | O=C(CSC(N1c2ccccc2)=Nc(cccc2)c2C1=O)N/N=C\c(s1)ccc1Br |
| InChI | InChI=1S/C21H15BrN4O2S2/c22-18-11-10-15(30-18)12-23-25-19(27)13-29-21-24-17-9-5-4-8-16(17)20(28)26(21)14-6-2-1-3-7-14/h1-12H,13H2,(H,25,27) |
| InChIK | GVCFWPRQLKUFND-UHFFFAOYSA-N |
| TotalMolweight | 499.412 |
| Molweight | 499.412 |
| MonoisotopicMass | 497.981977 |
| CLogP | 5.007 |
| CLogS | -6.986 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 330.09 |
| Relative PSA | 0.30889 |
| PolarSurfaceArea | 127.67 |
| Druglikeness | 3.2926 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide | 2 - N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide