| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3-bromo-4-fluorophenyl)methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C21H17N9O2BrF |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)cc(Br)c2F)=O)c1CN(CC1)c2c1cccc2 |
| InChI | InChI=1S/C21H17BrFN9O2/c22-14-9-12(5-6-15(14)23)10-25-27-21(33)18-17(32(30-26-18)20-19(24)28-34-29-20)11-31-8-7-13-3-1-2-4-16(13)31/h1-6,9-10H,7-8,11H2,(H2,24,28)(H,27,33) |
| InChIK | GVGBURCBDZTEAQ-UHFFFAOYSA-N |
| TotalMolweight | 526.329 |
| Molweight | 526.329 |
| MonoisotopicMass | 525.06726 |
| CLogP | 4.0273 |
| CLogS | -4.308 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 352.02 |
| Relative PSA | 0.34001 |
| PolarSurfaceArea | 140.35 |
| Druglikeness | 0.27578 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3-bromo-4-fluorophenyl)methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3-bromo-4-fluorophenyl)methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide