| MolName | 6-N-(4-fluorophenyl)-5-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| MolecularFormula | C21H13N8O4F |
| Smiles | [O-][N+](c(cc1)ccc1-c1ccc(/C=N/Nc2nc3nonc3nc2Nc(cc2)ccc2F)o1)=O |
| InChI | InChI=1S/C21H13FN8O4/c22-13-3-5-14(6-4-13)24-18-19(26-21-20(25-18)28-34-29-21)27-23-11-16-9-10-17(33-16)12-1-7-15(8-2-12)30(31)32/h1-11H,(H,24,25,28)(H,26,27,29) |
| InChIK | GVGCEYSCUXBJLZ-UHFFFAOYSA-N |
| TotalMolweight | 460.384 |
| Molweight | 460.384 |
| MonoisotopicMass | 460.10438 |
| CLogP | 5.7069 |
| CLogS | -7.75 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 339.26 |
| Relative PSA | 0.40367 |
| PolarSurfaceArea | 160.08 |
| Druglikeness | -0.99742 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-N-(4-fluorophenyl)-5-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine | 2 - 6-N-(4-fluorophenyl)-5-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine