| MolName | 2-chloro-5-[5-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoic acid |
| MolecularFormula | C23H17N2O5Cl |
| Smiles | OC(c(cc(cc1)-c2ccc(/C=N\N(C([C@H]([C@H]34)[C@@H]5C=C[C@H]4C54CC4)=O)C3=O)o2)c1Cl)=O |
| InChI | InChI=1S/C23H17ClN2O5/c24-16-5-1-11(9-13(16)22(29)30)17-6-2-12(31-17)10-25-26-20(27)18-14-3-4-15(19(18)21(26)28)23(14)7-8-23/h1-6,9-10,14-15,18-19H,7-8H2,(H,29,30)/t14-,15-,18-,19+/m1/s1 |
| InChIK | GVNHGGOBTZGUGO-RGCFKVTRSA-N |
| TotalMolweight | 436.85 |
| Molweight | 436.85 |
| MonoisotopicMass | 436.0826 |
| CLogP | 3.0761 |
| CLogS | -5.9 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 293.22 |
| Relative PSA | 0.27757 |
| PolarSurfaceArea | 100.18 |
| Druglikeness | 7.2494 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 7 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 1 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-chloro-5-[5-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoic acid | 2 - 2-chloro-5-[5-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoic acid