| MolName | N-[(Z)-(3-fluorophenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| MolecularFormula | C18H13N2O2F |
| Smiles | Oc1cc2ccccc2cc1C(N/N=C\c1cccc(F)c1)=O |
| InChI | InChI=1S/C18H13FN2O2/c19-15-7-3-4-12(8-15)11-20-21-18(23)16-9-13-5-1-2-6-14(13)10-17(16)22/h1-11,22H,(H,21,23) |
| InChIK | GVQBPFJFSHKNIG-UHFFFAOYSA-N |
| TotalMolweight | 308.311 |
| Molweight | 308.311 |
| MonoisotopicMass | 308.096106 |
| CLogP | 4.1511 |
| CLogS | -5.345 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 234.29 |
| Relative PSA | 0.20961 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 3.0804 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-fluorophenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide | 2 - N-[(Z)-(3-fluorophenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide