| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide |
| MolecularFormula | C17H13N8O3ClS |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2ccco2)=O)c1CSc(cc1)ccc1Cl |
| InChI | InChI=1S/C17H13ClN8O3S/c18-10-3-5-12(6-4-10)30-9-13-14(17(27)22-20-8-11-2-1-7-28-11)21-25-26(13)16-15(19)23-29-24-16/h1-8H,9H2,(H2,19,23)(H,22,27) |
| InChIK | GVRIWCZEIJVRKJ-UHFFFAOYSA-N |
| TotalMolweight | 444.862 |
| Molweight | 444.862 |
| MonoisotopicMass | 444.051984 |
| CLogP | 3.5055 |
| CLogS | -4.299 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 325.32 |
| Relative PSA | 0.45414 |
| PolarSurfaceArea | 175.55 |
| Druglikeness | 2.1422 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide