| MolName | N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide |
| MolecularFormula | C25H17N4O5ClS |
| Smiles | [O-][N+](c(cc(/C=N\NC(c1ccc(CN(c2cccc3cccc4c23)S4(=O)=O)cc1)=O)cc1)c1Cl)=O |
| InChI | InChI=1S/C25H17ClN4O5S/c26-20-12-9-17(13-22(20)30(32)33)14-27-28-25(31)19-10-7-16(8-11-19)15-29-21-5-1-3-18-4-2-6-23(24(18)21)36(29,34)35/h1-14H,15H2,(H,28,31) |
| InChIK | GWGSKRUBSDUCDS-UHFFFAOYSA-N |
| TotalMolweight | 520.952 |
| Molweight | 520.952 |
| MonoisotopicMass | 520.060818 |
| CLogP | 4.481 |
| CLogS | -8.203 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 359.58 |
| Relative PSA | 0.2741 |
| PolarSurfaceArea | 133.04 |
| Druglikeness | -6.6146 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide | 2 - N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide