| MolName | (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| MolecularFormula | C24H25N7O5 |
| Smiles | Nc1c2nc(N/N=C\c(cc3)ccc3OCc3ccccc3)n([C@H]([C@H]3O)O[C@@H](CO)[C@@H]3O)c2ncn1 |
| InChI | InChI=1S/C24H25N7O5/c25-21-18-22(27-13-26-21)31(23-20(34)19(33)17(11-32)36-23)24(29-18)30-28-10-14-6-8-16(9-7-14)35-12-15-4-2-1-3-5-15/h1-10,13,17,19-20,23,32-34H,11-12H2,(H,29,30)(H2,25,26,27)/t17-,19+,20+,23-/m0/s1 |
| InChIK | GWQIOASEJRELEB-CLWLKPMESA-N |
| TotalMolweight | 491.507 |
| Molweight | 491.507 |
| MonoisotopicMass | 491.191718 |
| CLogP | 3.1593 |
| CLogS | -5.47 |
| H Acceptors | 12 |
| H Donors | 5 |
| TotalSurfaceArea | 360.67 |
| Relative PSA | 0.38074 |
| PolarSurfaceArea | 173.16 |
| Druglikeness | 1.2283 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| StereoCenters | 4 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 11 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol | 2 - (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[(4-phenylmethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol