| MolName | 2-(1,3-benzodioxol-5-ylamino)-N-[(E)-(2-chlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C16H14N3O3Cl |
| Smiles | O=C(CNc(cc1)cc2c1OCO2)N/N=C/c(cccc1)c1Cl |
| InChI | InChI=1S/C16H14ClN3O3/c17-13-4-2-1-3-11(13)8-19-20-16(21)9-18-12-5-6-14-15(7-12)23-10-22-14/h1-8,18H,9-10H2,(H,20,21) |
| InChIK | GXBOYODLZPSARC-UHFFFAOYSA-N |
| TotalMolweight | 331.758 |
| Molweight | 331.758 |
| MonoisotopicMass | 331.072369 |
| CLogP | 3.2109 |
| CLogS | -4.99 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 247.89 |
| Relative PSA | 0.27218 |
| PolarSurfaceArea | 71.95 |
| Druglikeness | 4.8851 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzodioxol-5-ylamino)-N-[(E)-(2-chlorophenyl)methylideneamino]acetamide | 2 - 2-(1,3-benzodioxol-5-ylamino)-N-[(E)-(2-chlorophenyl)methylideneamino]acetamide