| MolName | N,N'-bis[(Z)-naphthalen-1-ylmethylideneamino]hexanediamide |
| MolecularFormula | C28H26N4O2 |
| Smiles | O=C(CCCCC(N/N=C\c1cccc2ccccc12)=O)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C28H26N4O2/c33-27(31-29-19-23-13-7-11-21-9-1-3-15-25(21)23)17-5-6-18-28(34)32-30-20-24-14-8-12-22-10-2-4-16-26(22)24/h1-4,7-16,19-20H,5-6,17-18H2,(H,31,33)(H,32,34) |
| InChIK | GXIKXKFOBBSRLO-UHFFFAOYSA-N |
| TotalMolweight | 450.54 |
| Molweight | 450.54 |
| MonoisotopicMass | 450.205576 |
| CLogP | 6.7448 |
| CLogS | -8.41 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 365.2 |
| Relative PSA | 0.19721 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -4.1295 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 4 |
| Symmetricatoms | 17 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-naphthalen-1-ylmethylideneamino]hexanediamide | 2 - N,N'-bis[(Z)-naphthalen-1-ylmethylideneamino]hexanediamide