| MolName | [3-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C32H23N3O8 |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c(cc1)cc2c1OCO2)N/N=C\c1cccc(OC(c(cc2)cc3c2OCO3)=O)c1 |
| InChI | InChI=1S/C32H23N3O8/c36-30(22-6-2-1-3-7-22)34-25(14-20-9-11-26-28(15-20)41-18-39-26)31(37)35-33-17-21-5-4-8-24(13-21)43-32(38)23-10-12-27-29(16-23)42-19-40-27/h1-17H,18-19H2,(H,34,36)(H,35,37) |
| InChIK | GXVDADUPCVBOIN-UHFFFAOYSA-N |
| TotalMolweight | 577.548 |
| Molweight | 577.548 |
| MonoisotopicMass | 577.148517 |
| CLogP | 6.4716 |
| CLogS | -8.358 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 428.7 |
| Relative PSA | 0.2882 |
| PolarSurfaceArea | 133.78 |
| Druglikeness | 6.1054 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48837 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [3-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate