| MolName | (Z)-N-(benzimidazol-1-yl)-1-[2-(difluoromethoxy)phenyl]methanimine |
| MolecularFormula | C15H11N3OF2 |
| Smiles | FC(Oc1c(/C=N\n2c(cccc3)c3nc2)cccc1)F |
| InChI | InChI=1S/C15H11F2N3O/c16-15(17)21-14-8-4-1-5-11(14)9-19-20-10-18-12-6-2-3-7-13(12)20/h1-10,15H |
| InChIK | GXYFXTFZCGMSTP-UHFFFAOYSA-N |
| TotalMolweight | 287.268 |
| Molweight | 287.268 |
| MonoisotopicMass | 287.087018 |
| CLogP | 3.2274 |
| CLogS | -6.193 |
| H Acceptors | 4 |
| TotalSurfaceArea | 215.54 |
| Relative PSA | 0.18256 |
| PolarSurfaceArea | 39.41 |
| Druglikeness | 0.69093 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Symmetricatoms | 1 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(benzimidazol-1-yl)-1-[2-(difluoromethoxy)phenyl]methanimine | 2 - (Z)-N-(benzimidazol-1-yl)-1-[2-(difluoromethoxy)phenyl]methanimine