| MolName | 2-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C22H16N9O4Cl |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(Nc2ccccc2)nc(N/N=C\c(cc2)cc([N+]([O-])=O)c2Cl)n1)=O |
| InChI | InChI=1S/C22H16ClN9O4/c23-18-11-6-14(12-19(18)32(35)36)13-24-30-22-28-20(25-15-4-2-1-3-5-15)27-21(29-22)26-16-7-9-17(10-8-16)31(33)34/h1-13H,(H3,25,26,27,28,29,30) |
| InChIK | GYALLKFXWWGHRC-UHFFFAOYSA-N |
| TotalMolweight | 505.881 |
| Molweight | 505.881 |
| MonoisotopicMass | 505.101378 |
| CLogP | 5.5749 |
| CLogS | -8.147 |
| H Acceptors | 13 |
| H Donors | 3 |
| TotalSurfaceArea | 370.72 |
| Relative PSA | 0.37667 |
| PolarSurfaceArea | 178.76 |
| Druglikeness | -2.9201 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine