| MolName | N-[(Z)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide |
| MolecularFormula | C29H25N2O4Br |
| Smiles | O=C(COc(cc1)ccc1OCc1ccccc1)N/N=C\c(cccc1)c1OCc(cc1)ccc1Br |
| InChI | InChI=1S/C29H25BrN2O4/c30-25-12-10-23(11-13-25)20-36-28-9-5-4-8-24(28)18-31-32-29(33)21-35-27-16-14-26(15-17-27)34-19-22-6-2-1-3-7-22/h1-18H,19-21H2,(H,32,33) |
| InChIK | GYWBPYCZEKYTFN-UHFFFAOYSA-N |
| TotalMolweight | 545.431 |
| Molweight | 545.431 |
| MonoisotopicMass | 544.099769 |
| CLogP | 6.1979 |
| CLogS | -7.017 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 396.42 |
| Relative PSA | 0.16652 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | 2.4066 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69444 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide | 2 - N-[(Z)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide