| MolName | 2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]-[(Z)-2-[6'-[(2-nitrophenyl)methoxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxyethylideneamino]amino]acetic acid |
| MolecularFormula | C37H26N4O12 |
| Smiles | [O-][N+](c1c(COc2cc(Oc3c(C4(c5c6cccc5)OC6=O)ccc(OC/C=N\N(CC(O)=O)C(CN(C(C=C5)=O)C5=O)=O)c3)c4cc2)cccc1)=O |
| InChI | InChI=1S/C37H26N4O12/c42-32-13-14-33(43)39(32)19-34(44)40(20-35(45)46)38-15-16-50-23-9-11-27-30(17-23)52-31-18-24(51-21-22-5-1-4-8-29(22)41(48)49)10-12-28(31)37(27)26-7-3-2-6-25(26)36(47)53-37/h1-15,17-18H,16,19-21H2,(H,45,46)/t37-/m0/s1 |
| InChIK | GZOXQBWBZZHYKA-QNGWXLTQSA-N |
| TotalMolweight | 718.629 |
| Molweight | 718.629 |
| MonoisotopicMass | 718.154726 |
| CLogP | 2.0523 |
| CLogS | -6.116 |
| H Acceptors | 16 |
| H Donors | 1 |
| TotalSurfaceArea | 508.12 |
| Relative PSA | 0.32931 |
| PolarSurfaceArea | 207.16 |
| Druglikeness | -12.552 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.43396 |
| Fragments | 1 |
| Non HAtoms | 53 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| StereoCenters | 1 |
| Rotatable Bond | 12 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 11 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]-[(Z)-2-[6'-[(2-nitrophenyl)methoxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxyethylideneamino]amino]acetic acid | 2 - 2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]-[(Z)-2-[6'-[(2-nitrophenyl)methoxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxyethylideneamino]amino]acetic acid