| MolName | 4-N,6-N-bis[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C29H20N8Cl4 |
| Smiles | Clc1cc(Cl)c(/C=N\Nc2nc(N/N=C\c(ccc(Cl)c3)c3Cl)nc(N(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C29H20Cl4N8/c30-21-13-11-19(25(32)15-21)17-34-39-27-36-28(40-35-18-20-12-14-22(31)16-26(20)33)38-29(37-27)41(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-18H,(H2,36,37,38,39,40) |
| InChIK | GZPUUIVMTSLCMH-UHFFFAOYSA-N |
| TotalMolweight | 622.346 |
| Molweight | 622.346 |
| MonoisotopicMass | 620.0565 |
| CLogP | 12.462 |
| CLogS | -11.988 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 453 |
| Relative PSA | 0.1819 |
| PolarSurfaceArea | 90.69 |
| Druglikeness | 3.1495 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46341 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Symmetricatoms | 21 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N,6-N-bis[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine | 2 - 4-N,6-N-bis[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine