| MolName | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| MolecularFormula | C14H16N3O3F3S |
| Smiles | O=C(CN(CC1)CCS1(=O)=O)N/N=C\c1cc(C(F)(F)F)ccc1 |
| InChI | InChI=1S/C14H16F3N3O3S/c15-14(16,17)12-3-1-2-11(8-12)9-18-19-13(21)10-20-4-6-24(22,23)7-5-20/h1-3,8-9H,4-7,10H2,(H,19,21) |
| InChIK | GZRBFWSSBOFAKT-UHFFFAOYSA-N |
| TotalMolweight | 363.359 |
| Molweight | 363.359 |
| MonoisotopicMass | 363.086446 |
| CLogP | 1.1826 |
| CLogS | -2.648 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 250.87 |
| Relative PSA | 0.27161 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | -3.8755 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 5 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide | 2 - 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide