| MolName | [(Z)-[2-[4-[(2Z)-2-(carbamoylhydrazinylidene)acetyl]phenyl]-2-oxoethylidene]amino]urea |
| MolecularFormula | C12H12N6O4 |
| Smiles | NC(N/N=C\C(c(cc1)ccc1C(/C=N\NC(N)=O)=O)=O)=O |
| InChI | InChI=1S/C12H12N6O4/c13-11(21)17-15-5-9(19)7-1-2-8(4-3-7)10(20)6-16-18-12(14)22/h1-6H,(H3,13,17,21)(H3,14,18,22) |
| InChIK | GZUMLQGDIIYJEA-UHFFFAOYSA-N |
| TotalMolweight | 304.265 |
| Molweight | 304.265 |
| MonoisotopicMass | 304.092004 |
| CLogP | -1.7912 |
| CLogS | -4.148 |
| H Acceptors | 10 |
| H Donors | 4 |
| TotalSurfaceArea | 233.74 |
| Relative PSA | 0.55036 |
| PolarSurfaceArea | 169.1 |
| Druglikeness | 4.5865 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Symmetricatoms | 12 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[2-[4-[(2Z)-2-(carbamoylhydrazinylidene)acetyl]phenyl]-2-oxoethylidene]amino]urea | 2 - [(Z)-[2-[4-[(2Z)-2-(carbamoylhydrazinylidene)acetyl]phenyl]-2-oxoethylidene]amino]urea