| MolName | 2-N-[(Z)-(4-iodophenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C22H17N8O2I |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(Nc2ccccc2)nc(N/N=C\c(cc2)ccc2I)n1)=O |
| InChI | InChI=1S/C22H17IN8O2/c23-16-8-6-15(7-9-16)14-24-30-22-28-20(25-17-4-2-1-3-5-17)27-21(29-22)26-18-10-12-19(13-11-18)31(32)33/h1-14H,(H3,25,26,27,28,29,30) |
| InChIK | HAAMTGDFVYSXBN-UHFFFAOYSA-N |
| TotalMolweight | 552.331 |
| Molweight | 552.331 |
| MonoisotopicMass | 552.05192 |
| CLogP | 6.3276 |
| CLogS | -7.967 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 357.91 |
| Relative PSA | 0.30516 |
| PolarSurfaceArea | 132.94 |
| Druglikeness | -2.3775 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(4-iodophenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N-[(Z)-(4-iodophenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine