| MolName | 5-[(Z)-[[2-(4-phenylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
| MolecularFormula | C19H15N2O6S |
| Smiles | [O-]S(c1ccc(/C=N\NC(COc(cc2)ccc2-c2ccccc2)=O)o1)(=O)=O |
| InChI | InChI=1S/C19H16N2O6S/c22-18(21-20-12-17-10-11-19(27-17)28(23,24)25)13-26-16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-12H,13H2,(H,21,22)(H,23,24,25)/p-1 |
| InChIK | HACCANHYGFTDAH-UHFFFAOYSA-M |
| TotalMolweight | 399.402 |
| Molweight | 399.402 |
| MonoisotopicMass | 399.065083 |
| CLogP | 0.2449 |
| CLogS | -3.638 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 296.31 |
| Relative PSA | 0.34754 |
| PolarSurfaceArea | 129.41 |
| Druglikeness | 0.85131 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-[[2-(4-phenylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate | 2 - 5-[(Z)-[[2-(4-phenylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate